C34H19N5 — CID 162693852
10-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyano-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene (PubChem CID 162693852) has the molecular formula C34H19N5 and a molecular weight of 497.56 g/mol. Its IUPAC name is 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyano-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene.
| Compound Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyano-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
|---|---|
| PubChem CID | 162693852 |
| Molecular Formula | C34H19N5 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyano-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc3c4ccccc4n2c31 |
| InChI | InChI=1S/C34H19N5/c1-35-24-16-17-30-26(20-24)28-19-23(18-27-25-14-8-9-15-29(25)39(30)31(27)28)34-37-32(21-10-4-2-5-11-21)36-33(38-34)22-12-6-3-7-13-22/h2-20H |
| InChIKey | AAAGAHIWSAAFJW-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 47.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|