C54H33N7 — CID 168720024
5,15-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene (PubChem CID 168720024) has the molecular formula C54H33N7 and a molecular weight of 779.91 g/mol. Its IUPAC name is 5,15-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene.
| Compound Name | 5,15-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene |
|---|---|
| PubChem CID | 168720024 |
| Molecular Formula | C54H33N7 |
| Molecular Weight | 779.91 g/mol |
| Exact Mass | 779.28 |
| IUPAC Name | 5,15-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene |
| SMILES | c1ccc(-c2cc3c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc4n4c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5c(c2)c34)cc1 |
| InChI | InChI=1S/C54H33N7/c1-6-16-34(17-7-1)41-32-44-42-30-39(53-57-49(35-18-8-2-9-19-35)55-50(58-53)36-20-10-3-11-21-36)26-28-46(42)61-47-29-27-40(31-43(47)45(33-41)48(44)61)54-59-51(37-22-12-4-13-23-37)56-52(60-54)38-24-14-5-15-25-38/h1-33H |
| InChIKey | FWVKPCGCFWWZIH-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.91 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |