C41H27N5 — CID 165004302
3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanophenyl]-9-(2-methylphenyl)carbazole (PubChem CID 165004302) has the molecular formula C41H27N5 and a molecular weight of 589.70 g/mol. Its IUPAC name is 3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanophenyl]-9-(2-methylphenyl)carbazole.
| Compound Name | 3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanophenyl]-9-(2-methylphenyl)carbazole |
|---|---|
| PubChem CID | 165004302 |
| Molecular Formula | C41H27N5 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanophenyl]-9-(2-methylphenyl)carbazole |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-c2ccc3c(c2)c2ccccc2n3-c2ccccc2C)c1 |
| InChI | InChI=1S/C41H27N5/c1-27-13-9-11-19-36(27)46-37-20-12-10-18-32(37)35-25-30(21-24-38(35)46)34-26-31(42-2)22-23-33(34)41-44-39(28-14-5-3-6-15-28)43-40(45-41)29-16-7-4-8-17-29/h3-26H,1H3 |
| InChIKey | BITCFOZAIQXVQE-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|