C67H37N9 — CID 155636724
4-[9-[4-(2-carbazol-9-ylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-cyano-4-isocyanophenyl)carbazol-3-yl]-3-isocyanobenzonitrile (PubChem CID 155636724) has the molecular formula C67H37N9 and a molecular weight of 968.10 g/mol. Its IUPAC name is 4-[9-[4-(2-carbazol-9-ylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-cyano-4-isocyanophenyl)carbazol-3-yl]-3-isocyanobenzonitrile.
| Compound Name | 4-[9-[4-(2-carbazol-9-ylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-cyano-4-isocyanophenyl)carbazol-3-yl]-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 155636724 |
| Molecular Formula | C67H37N9 |
| Molecular Weight | 968.10 g/mol |
| Exact Mass | 967.32 |
| IUPAC Name | 4-[9-[4-(2-carbazol-9-ylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-cyano-4-isocyanophenyl)carbazol-3-yl]-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C#N)cc4[N+]#[C-])ccc2n3-c2ccc(-c3ccccc3-n3c4ccccc4c4ccccc43)cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(C#N)c1 |
| InChI | InChI=1S/C67H37N9/c1-70-49-29-31-50(48(36-49)41-69)45-26-32-62-55(37-45)56-38-46(51-30-25-42(40-68)35-58(51)71-2)27-33-63(56)76(62)64-34-28-47(52-19-9-12-22-59(52)75-60-23-13-10-20-53(60)54-21-11-14-24-61(54)75)39-57(64)67-73-65(43-15-5-3-6-16-43)72-66(74-67)44-17-7-4-8-18-44/h3-39H |
| InChIKey | IZRKNZVHHYEUII-UHFFFAOYSA-N |
| XLogP | 16.91 |
| TPSA | 104.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.10 |
| LogP ≤ 5 | 16.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|