C61H32N8O — CID 169045311
4-[7-(2-cyano-4-isocyanophenyl)-9-[4-dibenzofuran-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]-3-isocyanobenzonitrile (PubChem CID 169045311) has the molecular formula C61H32N8O and a molecular weight of 892.98 g/mol. Its IUPAC name is 4-[7-(2-cyano-4-isocyanophenyl)-9-[4-dibenzofuran-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]-3-isocyanobenzonitrile.
| Compound Name | 4-[7-(2-cyano-4-isocyanophenyl)-9-[4-dibenzofuran-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 169045311 |
| Molecular Formula | C61H32N8O |
| Molecular Weight | 892.98 g/mol |
| Exact Mass | 892.27 |
| IUPAC Name | 4-[7-(2-cyano-4-isocyanophenyl)-9-[4-dibenzofuran-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-2-yl]-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c4ccc(-c5ccc(C#N)cc5[N+]#[C-])cc4n(-c4ccc(-c5cccc6oc7ccccc7c56)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)c(C#N)c1 |
| InChI | InChI=1S/C61H32N8O/c1-64-44-24-28-45(43(31-44)36-63)41-21-26-48-49-27-22-42(46-25-20-37(35-62)30-52(46)65-2)34-55(49)69(54(48)33-41)53-29-23-40(47-17-11-19-57-58(47)50-16-9-10-18-56(50)70-57)32-51(53)61-67-59(38-12-5-3-6-13-38)66-60(68-61)39-14-7-4-8-15-39/h3-34H |
| InChIKey | PAFBJFGFJAFSSC-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.98 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|