C42H23N7 — CID 140871886
4-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 140871886) has the molecular formula C42H23N7 and a molecular weight of 625.70 g/mol. Its IUPAC name is 4-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 4-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 140871886 |
| Molecular Formula | C42H23N7 |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.20 |
| IUPAC Name | 4-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c(c2)c2ccccc2n3-c2ccc(C#N)cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c([N+]#[C-])c1 |
| InChI | InChI=1S/C42H23N7/c1-44-31-19-20-32(36(25-31)45-2)30-18-22-38-34(24-30)33-15-9-10-16-37(33)49(38)39-21-17-27(26-43)23-35(39)42-47-40(28-11-5-3-6-12-28)46-41(48-42)29-13-7-4-8-14-29/h3-25H |
| InChIKey | ZNUBFQKASSJNFO-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|