C55H29N9 — CID 154603054
9-[4-cyano-2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-isocyanocarbazol-9-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile (PubChem CID 154603054) has the molecular formula C55H29N9 and a molecular weight of 815.90 g/mol. Its IUPAC name is 9-[4-cyano-2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-isocyanocarbazol-9-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile.
| Compound Name | 9-[4-cyano-2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-isocyanocarbazol-9-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 154603054 |
| Molecular Formula | C55H29N9 |
| Molecular Weight | 815.90 g/mol |
| Exact Mass | 815.25 |
| IUPAC Name | 9-[4-cyano-2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-isocyanocarbazol-9-yl)phenyl]phenyl]-6-isocyanocarbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-c2cc(C#N)ccc2-n2c3ccc(C#N)cc3c3cc([N+]#[C-])ccc32)c1 |
| InChI | InChI=1S/C55H29N9/c1-58-38-19-25-49-46(29-38)41-15-9-10-16-48(41)63(49)40-21-22-42(55-61-53(36-11-5-3-6-12-36)60-54(62-55)37-13-7-4-8-14-37)43(31-40)44-27-34(32-56)17-23-50(44)64-51-24-18-35(33-57)28-45(51)47-30-39(59-2)20-26-52(47)64/h3-31H |
| InChIKey | KUCFPRMAYNDESV-UHFFFAOYSA-N |
| XLogP | 13.58 |
| TPSA | 104.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.90 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|