C77H47N7 — CID 170664824
3-(3,6-diphenylcarbazol-9-yl)-4-[4-[2-(3,6-diphenylcarbazol-9-yl)-5-(2-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 170664824) has the molecular formula C77H47N7 and a molecular weight of 1070.27 g/mol. Its IUPAC name is 3-(3,6-diphenylcarbazol-9-yl)-4-[4-[2-(3,6-diphenylcarbazol-9-yl)-5-(2-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 3-(3,6-diphenylcarbazol-9-yl)-4-[4-[2-(3,6-diphenylcarbazol-9-yl)-5-(2-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 170664824 |
| Molecular Formula | C77H47N7 |
| Molecular Weight | 1070.27 g/mol |
| Exact Mass | 1069.39 |
| IUPAC Name | 3-(3,6-diphenylcarbazol-9-yl)-4-[4-[2-(3,6-diphenylcarbazol-9-yl)-5-(2-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c(-c2nc(-c3ccccc3)nc(-c3ccc(C#N)cc3-n3c4ccc(-c5ccccc5)cc4c4cc(-c5ccccc5)ccc43)n2)c1 |
| InChI | InChI=1S/C77H47N7/c1-79-68-30-18-17-29-61(68)60-36-42-73(83-69-38-32-56(51-19-7-2-8-20-51)44-63(69)64-45-57(33-39-70(64)83)52-21-9-3-10-22-52)67(48-60)77-81-75(55-27-15-6-16-28-55)80-76(82-77)62-37-31-50(49-78)43-74(62)84-71-40-34-58(53-23-11-4-12-24-53)46-65(71)66-47-59(35-41-72(66)84)54-25-13-5-14-26-54/h2-48H |
| InChIKey | GMDCWEZGOARJDF-UHFFFAOYSA-N |
| XLogP | 19.82 |
| TPSA | 76.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.27 |
| LogP ≤ 5 | 19.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|