C47H31N5 — CID 164971940
3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanophenyl]-9-(2-methylphenyl)-6-phenylcarbazole (PubChem CID 164971940) has the molecular formula C47H31N5 and a molecular weight of 665.80 g/mol. Its IUPAC name is 3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanophenyl]-9-(2-methylphenyl)-6-phenylcarbazole.
| Compound Name | 3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanophenyl]-9-(2-methylphenyl)-6-phenylcarbazole |
|---|---|
| PubChem CID | 164971940 |
| Molecular Formula | C47H31N5 |
| Molecular Weight | 665.80 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | 3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-isocyanophenyl]-9-(2-methylphenyl)-6-phenylcarbazole |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2ccccc2C)c1 |
| InChI | InChI=1S/C47H31N5/c1-31-14-12-13-21-42(31)52-43-26-22-35(32-15-6-3-7-16-32)28-40(43)41-29-36(23-27-44(41)52)39-30-37(48-2)24-25-38(39)47-50-45(33-17-8-4-9-18-33)49-46(51-47)34-19-10-5-11-20-34/h3-30H,1H3 |
| InChIKey | LXNSWIRVOHYEDK-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.80 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|