C49H30N6 — CID 123192697
3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-6-isocyano-9-quinolin-2-ylcarbazole (PubChem CID 123192697) has the molecular formula C49H30N6 and a molecular weight of 702.82 g/mol. Its IUPAC name is 3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-6-isocyano-9-quinolin-2-ylcarbazole.
| Compound Name | 3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-6-isocyano-9-quinolin-2-ylcarbazole |
|---|---|
| PubChem CID | 123192697 |
| Molecular Formula | C49H30N6 |
| Molecular Weight | 702.82 g/mol |
| Exact Mass | 702.25 |
| IUPAC Name | 3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-6-isocyano-9-quinolin-2-ylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5ccccc5)cc4)n3)ccc1n2-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C49H30N6/c1-50-40-26-28-45-42(31-40)41-30-39(24-27-44(41)55(45)46-29-25-36-14-8-9-15-43(36)51-46)49-53-47(37-20-16-34(17-21-37)32-10-4-2-5-11-32)52-48(54-49)38-22-18-35(19-23-38)33-12-6-3-7-13-33/h2-31H |
| InChIKey | HWKRWWABPGPQEZ-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 60.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.82 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|