C51H30N6 — CID 123833312
3-[10-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]-6-isocyano-9-quinolin-2-ylcarbazole (PubChem CID 123833312) has the molecular formula C51H30N6 and a molecular weight of 726.84 g/mol. Its IUPAC name is 3-[10-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]-6-isocyano-9-quinolin-2-ylcarbazole.
| Compound Name | 3-[10-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]-6-isocyano-9-quinolin-2-ylcarbazole |
|---|---|
| PubChem CID | 123833312 |
| Molecular Formula | C51H30N6 |
| Molecular Weight | 726.84 g/mol |
| Exact Mass | 726.25 |
| IUPAC Name | 3-[10-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]-6-isocyano-9-quinolin-2-ylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3c4ccccc4c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c4ccccc34)ccc1n2-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C51H30N6/c1-52-36-26-28-45-42(31-36)41-30-35(24-27-44(41)57(45)46-29-25-32-14-8-13-23-43(32)53-46)47-37-19-9-11-21-39(37)48(40-22-12-10-20-38(40)47)51-55-49(33-15-4-2-5-16-33)54-50(56-51)34-17-6-3-7-18-34/h2-31H |
| InChIKey | IYUNLCJHELAQBP-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 60.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.84 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|