C46H28N6 — CID 166592078
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14-(4-isocyanophenyl)-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 166592078) has the molecular formula C46H28N6 and a molecular weight of 664.77 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14-(4-isocyanophenyl)-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14-(4-isocyanophenyl)-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 166592078 |
| Molecular Formula | C46H28N6 |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14-(4-isocyanophenyl)-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | [C-]#[N+]c1ccc(-n2c3ccccc3c3c4c5ccccc5n(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)c4ccc32)cc1 |
| InChI | InChI=1S/C46H28N6/c1-47-33-23-25-34(26-24-33)51-38-21-10-8-19-36(38)42-40(51)27-28-41-43(42)37-20-9-11-22-39(37)52(41)35-18-12-17-32(29-35)46-49-44(30-13-4-2-5-14-30)48-45(50-46)31-15-6-3-7-16-31/h2-29H |
| InChIKey | FLPQWMAVSNRUNN-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 52.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|