C45H27N7 — CID 140820509
20-[3-[4-(3-isocyanophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenyl-9,18,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene (PubChem CID 140820509) has the molecular formula C45H27N7 and a molecular weight of 665.76 g/mol. Its IUPAC name is 20-[3-[4-(3-isocyanophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenyl-9,18,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene.
| Compound Name | 20-[3-[4-(3-isocyanophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenyl-9,18,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 140820509 |
| Molecular Formula | C45H27N7 |
| Molecular Weight | 665.76 g/mol |
| Exact Mass | 665.23 |
| IUPAC Name | 20-[3-[4-(3-isocyanophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenyl-9,18,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene |
| SMILES | [C-]#[N+]c1cccc(-c2nc(-c3ccccc3)nc(-c3cccc(-n4c5ncccc5c5ccc6c(c7ccccc7n6-c6ccccc6)c54)c3)n2)c1 |
| InChI | InChI=1S/C45H27N7/c1-46-32-17-10-15-30(27-32)43-48-42(29-13-4-2-5-14-29)49-44(50-43)31-16-11-20-34(28-31)52-41-35(36-22-12-26-47-45(36)52)24-25-39-40(41)37-21-8-9-23-38(37)51(39)33-18-6-3-7-19-33/h2-28H |
| InChIKey | MRVCQIZJPDEOSQ-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 65.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.76 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|