C56H47N3Si — CID 171574330
[3-[6-[4-(1-adamantyl)phenyl]-2-carbazol-9-ylpyrimidin-4-yl]phenyl]-triphenylsilane (PubChem CID 171574330) has the molecular formula C56H47N3Si and a molecular weight of 790.10 g/mol. Its IUPAC name is [3-[6-[4-(1-adamantyl)phenyl]-2-carbazol-9-ylpyrimidin-4-yl]phenyl]-triphenylsilane.
| Compound Name | [3-[6-[4-(1-adamantyl)phenyl]-2-carbazol-9-ylpyrimidin-4-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 171574330 |
| Molecular Formula | C56H47N3Si |
| Molecular Weight | 790.10 g/mol |
| Exact Mass | 789.35 |
| IUPAC Name | [3-[6-[4-(1-adamantyl)phenyl]-2-carbazol-9-ylpyrimidin-4-yl]phenyl]-triphenylsilane |
| SMILES | c1ccc([Si](c2ccccc2)(c2ccccc2)c2cccc(-c3cc(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)nc(-n4c5ccccc5c5ccccc54)n3)c2)cc1 |
| InChI | InChI=1S/C56H47N3Si/c1-4-16-45(17-5-1)60(46-18-6-2-7-19-46,47-20-8-3-9-21-47)48-22-14-15-43(34-48)52-35-51(42-27-29-44(30-28-42)56-36-39-31-40(37-56)33-41(32-39)38-56)57-55(58-52)59-53-25-12-10-23-49(53)50-24-11-13-26-54(50)59/h1-30,34-35,39-41H,31-33,36-38H2 |
| InChIKey | GHUYZYJWDYQYAT-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.10 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|