C51H46N3OP — CID 176628708
2-[4-[2-[4-(4-dimethylphosphorylphenyl)phenyl]-2-adamantyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 176628708) has the molecular formula C51H46N3OP and a molecular weight of 747.92 g/mol. Its IUPAC name is 2-[4-[2-[4-(4-dimethylphosphorylphenyl)phenyl]-2-adamantyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[2-[4-(4-dimethylphosphorylphenyl)phenyl]-2-adamantyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176628708 |
| Molecular Formula | C51H46N3OP |
| Molecular Weight | 747.92 g/mol |
| Exact Mass | 747.34 |
| IUPAC Name | 2-[4-[2-[4-(4-dimethylphosphorylphenyl)phenyl]-2-adamantyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | CP(C)(=O)c1ccc(-c2ccc(C3(c4ccc(-c5nc(-c6ccccc6)nc(-c6cccc(-c7ccccc7)c6)n5)cc4)C4CC5CC(C4)CC3C5)cc2)cc1 |
| InChI | InChI=1S/C51H46N3OP/c1-56(2,55)47-26-20-38(21-27-47)37-16-22-43(23-17-37)51(45-29-34-28-35(31-45)32-46(51)30-34)44-24-18-40(19-25-44)49-52-48(39-12-7-4-8-13-39)53-50(54-49)42-15-9-14-41(33-42)36-10-5-3-6-11-36/h3-27,33-35,45-46H,28-32H2,1-2H3 |
| InChIKey | GOAQXNFDYCOPOF-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.92 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|