C63H52N3OP — CID 176628556
2-[4-[2-[4-[10-(4-dimethylphosphorylphenyl)anthracen-9-yl]phenyl]-2-adamantyl]phenyl]-4-naphthalen-1-yl-6-phenyl-1,3,5-triazine (PubChem CID 176628556) has the molecular formula C63H52N3OP and a molecular weight of 898.10 g/mol. Its IUPAC name is 2-[4-[2-[4-[10-(4-dimethylphosphorylphenyl)anthracen-9-yl]phenyl]-2-adamantyl]phenyl]-4-naphthalen-1-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[4-[2-[4-[10-(4-dimethylphosphorylphenyl)anthracen-9-yl]phenyl]-2-adamantyl]phenyl]-4-naphthalen-1-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176628556 |
| Molecular Formula | C63H52N3OP |
| Molecular Weight | 898.10 g/mol |
| Exact Mass | 897.38 |
| IUPAC Name | 2-[4-[2-[4-[10-(4-dimethylphosphorylphenyl)anthracen-9-yl]phenyl]-2-adamantyl]phenyl]-4-naphthalen-1-yl-6-phenyl-1,3,5-triazine |
| SMILES | CP(C)(=O)c1ccc(-c2c3ccccc3c(-c3ccc(C4(c5ccc(-c6nc(-c7ccccc7)nc(-c7cccc8ccccc78)n6)cc5)C5CC6CC(C5)CC4C6)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C63H52N3OP/c1-68(2,67)51-33-27-44(28-34-51)59-55-20-10-8-18-53(55)58(54-19-9-11-21-56(54)59)43-23-29-47(30-24-43)63(49-36-40-35-41(38-49)39-50(63)37-40)48-31-25-46(26-32-48)61-64-60(45-14-4-3-5-15-45)65-62(66-61)57-22-12-16-42-13-6-7-17-52(42)57/h3-34,40-41,49-50H,35-39H2,1-2H3 |
| InChIKey | FKROATFMAOUDLU-UHFFFAOYSA-N |
| XLogP | 15.66 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.10 |
| LogP ≤ 5 | 15.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|