C59H50N3OP — CID 176628622
2-[4-[1-[4-(4-dimethylphosphorylphenyl)phenyl]cyclohexyl]phenyl]-4-(3-phenylphenyl)-6-[4-(2-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 176628622) has the molecular formula C59H50N3OP and a molecular weight of 848.04 g/mol. Its IUPAC name is 2-[4-[1-[4-(4-dimethylphosphorylphenyl)phenyl]cyclohexyl]phenyl]-4-(3-phenylphenyl)-6-[4-(2-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[4-[1-[4-(4-dimethylphosphorylphenyl)phenyl]cyclohexyl]phenyl]-4-(3-phenylphenyl)-6-[4-(2-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176628622 |
| Molecular Formula | C59H50N3OP |
| Molecular Weight | 848.04 g/mol |
| Exact Mass | 847.37 |
| IUPAC Name | 2-[4-[1-[4-(4-dimethylphosphorylphenyl)phenyl]cyclohexyl]phenyl]-4-(3-phenylphenyl)-6-[4-(2-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | CP(C)(=O)c1ccc(-c2ccc(C3(c4ccc(-c5nc(-c6ccc(-c7ccccc7-c7ccccc7)cc6)nc(-c6cccc(-c7ccccc7)c6)n5)cc4)CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C59H50N3OP/c1-64(2,63)53-37-31-44(32-38-53)43-27-33-51(34-28-43)59(39-12-5-13-40-59)52-35-29-48(30-36-52)57-60-56(61-58(62-57)50-20-14-19-49(41-50)42-15-6-3-7-16-42)47-25-23-46(24-26-47)55-22-11-10-21-54(55)45-17-8-4-9-18-45/h3-4,6-11,14-38,41H,5,12-13,39-40H2,1-2H3 |
| InChIKey | LIQAMYLXMUERFS-UHFFFAOYSA-N |
| XLogP | 15.04 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.04 |
| LogP ≤ 5 | 15.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|