C45H37N3 — CID 121315417
2,4-diphenyl-6-[4-[1-[4-(3-phenylphenyl)phenyl]cyclohexyl]phenyl]-1,3,5-triazine (PubChem CID 121315417) has the molecular formula C45H37N3 and a molecular weight of 619.81 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-[1-[4-(3-phenylphenyl)phenyl]cyclohexyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-[1-[4-(3-phenylphenyl)phenyl]cyclohexyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 121315417 |
| Molecular Formula | C45H37N3 |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | 2,4-diphenyl-6-[4-[1-[4-(3-phenylphenyl)phenyl]cyclohexyl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3ccc(C4(c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)CCCCC4)cc3)c2)cc1 |
| InChI | InChI=1S/C45H37N3/c1-5-14-33(15-6-1)38-20-13-21-39(32-38)34-22-26-40(27-23-34)45(30-11-4-12-31-45)41-28-24-37(25-29-41)44-47-42(35-16-7-2-8-17-35)46-43(48-44)36-18-9-3-10-19-36/h1-3,5-10,13-29,32H,4,11-12,30-31H2 |
| InChIKey | VJAWCNRTIBVOAY-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |