C47H42N3OP — CID 176628725
2-[4-[1-[4-(3-dimethylphosphorylphenyl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 176628725) has the molecular formula C47H42N3OP and a molecular weight of 695.85 g/mol. Its IUPAC name is 2-[4-[1-[4-(3-dimethylphosphorylphenyl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[1-[4-(3-dimethylphosphorylphenyl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176628725 |
| Molecular Formula | C47H42N3OP |
| Molecular Weight | 695.85 g/mol |
| Exact Mass | 695.31 |
| IUPAC Name | 2-[4-[1-[4-(3-dimethylphosphorylphenyl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | CP(C)(=O)c1cccc(-c2ccc(C3(c4ccc(-c5nc(-c6ccccc6)nc(-c6cccc(-c7ccccc7)c6)n5)cc4)CCCCC3)cc2)c1 |
| InChI | InChI=1S/C47H42N3OP/c1-52(2,51)43-21-13-19-39(33-43)35-22-26-41(27-23-35)47(30-10-5-11-31-47)42-28-24-37(25-29-42)45-48-44(36-16-8-4-9-17-36)49-46(50-45)40-20-12-18-38(32-40)34-14-6-3-7-15-34/h3-4,6-9,12-29,32-33H,5,10-11,30-31H2,1-2H3 |
| InChIKey | DFJNFAVGYWIGNG-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.85 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|