C61H48N3OP — CID 176628365
2-[4-[1-[4-(4-diphenylphosphorylnaphthalen-1-yl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 176628365) has the molecular formula C61H48N3OP and a molecular weight of 870.05 g/mol. Its IUPAC name is 2-[4-[1-[4-(4-diphenylphosphorylnaphthalen-1-yl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[1-[4-(4-diphenylphosphorylnaphthalen-1-yl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176628365 |
| Molecular Formula | C61H48N3OP |
| Molecular Weight | 870.05 g/mol |
| Exact Mass | 869.35 |
| IUPAC Name | 2-[4-[1-[4-(4-diphenylphosphorylnaphthalen-1-yl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2ccc(C3(c4ccc(-c5nc(-c6ccccc6)nc(-c6cccc(-c7ccccc7)c6)n5)cc4)CCCCC3)cc2)c2ccccc12 |
| InChI | InChI=1S/C61H48N3OP/c65-66(52-25-10-3-11-26-52,53-27-12-4-13-28-53)57-40-39-54(55-29-14-15-30-56(55)57)45-31-35-50(36-32-45)61(41-16-5-17-42-61)51-37-33-47(34-38-51)59-62-58(46-21-8-2-9-22-46)63-60(64-59)49-24-18-23-48(43-49)44-19-6-1-7-20-44/h1-4,6-15,18-40,43H,5,16-17,41-42H2 |
| InChIKey | LOQZTXBKTDUBPJ-UHFFFAOYSA-N |
| XLogP | 14.25 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.05 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|