C63H50N3OP — CID 176628287
2-[4-[1-[4-(10-dimethylphosphorylanthracen-9-yl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(10-phenylanthracen-9-yl)-1,3,5-triazine (PubChem CID 176628287) has the molecular formula C63H50N3OP and a molecular weight of 896.09 g/mol. Its IUPAC name is 2-[4-[1-[4-(10-dimethylphosphorylanthracen-9-yl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(10-phenylanthracen-9-yl)-1,3,5-triazine.
| Compound Name | 2-[4-[1-[4-(10-dimethylphosphorylanthracen-9-yl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(10-phenylanthracen-9-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176628287 |
| Molecular Formula | C63H50N3OP |
| Molecular Weight | 896.09 g/mol |
| Exact Mass | 895.37 |
| IUPAC Name | 2-[4-[1-[4-(10-dimethylphosphorylanthracen-9-yl)phenyl]cyclohexyl]phenyl]-4-phenyl-6-(10-phenylanthracen-9-yl)-1,3,5-triazine |
| SMILES | CP(C)(=O)c1c2ccccc2c(-c2ccc(C3(c4ccc(-c5nc(-c6ccccc6)nc(-c6c7ccccc7c(-c7ccccc7)c7ccccc67)n5)cc4)CCCCC3)cc2)c2ccccc12 |
| InChI | InChI=1S/C63H50N3OP/c1-68(2,67)59-54-30-16-14-28-52(54)57(53-29-15-17-31-55(53)59)43-32-36-46(37-33-43)63(40-18-5-19-41-63)47-38-34-45(35-39-47)61-64-60(44-22-8-4-9-23-44)65-62(66-61)58-50-26-12-10-24-48(50)56(42-20-6-3-7-21-42)49-25-11-13-27-51(49)58/h3-4,6-17,20-39H,5,18-19,40-41H2,1-2H3 |
| InChIKey | XXPGAVCJSLUNNW-UHFFFAOYSA-N |
| XLogP | 16.32 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.09 |
| LogP ≤ 5 | 16.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|