C38H32N4 — CID 130392322
2,4-diphenyl-6-[4-[1-(4-pyridin-2-ylphenyl)cyclohexyl]phenyl]-1,3,5-triazine (PubChem CID 130392322) has the molecular formula C38H32N4 and a molecular weight of 544.70 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-[1-(4-pyridin-2-ylphenyl)cyclohexyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-[1-(4-pyridin-2-ylphenyl)cyclohexyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 130392322 |
| Molecular Formula | C38H32N4 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 2,4-diphenyl-6-[4-[1-(4-pyridin-2-ylphenyl)cyclohexyl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(C4(c5ccc(-c6ccccn6)cc5)CCCCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C38H32N4/c1-4-12-29(13-5-1)35-40-36(30-14-6-2-7-15-30)42-37(41-35)31-19-23-33(24-20-31)38(25-9-3-10-26-38)32-21-17-28(18-22-32)34-16-8-11-27-39-34/h1-2,4-8,11-24,27H,3,9-10,25-26H2 |
| InChIKey | BQIKFTKOHSQKIV-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |