C48H38N4 — CID 130392474
8-[4-[1-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]cyclohexyl]phenyl]quinoline (PubChem CID 130392474) has the molecular formula C48H38N4 and a molecular weight of 670.86 g/mol. Its IUPAC name is 8-[4-[1-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]cyclohexyl]phenyl]quinoline.
| Compound Name | 8-[4-[1-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]cyclohexyl]phenyl]quinoline |
|---|---|
| PubChem CID | 130392474 |
| Molecular Formula | C48H38N4 |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | 8-[4-[1-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]cyclohexyl]phenyl]quinoline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(C5(c6ccc(-c7cccc8cccnc78)cc6)CCCCC5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C48H38N4/c1-4-12-34(13-5-1)35-19-21-39(22-20-35)46-50-45(38-14-6-2-7-15-38)51-47(52-46)40-25-29-42(30-26-40)48(31-8-3-9-32-48)41-27-23-36(24-28-41)43-18-10-16-37-17-11-33-49-44(37)43/h1-2,4-7,10-30,33H,3,8-9,31-32H2 |
| InChIKey | OZOMJPJDWXPGAX-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |