C46H30N4 — CID 121402277
8-[4-[8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]quinoline (PubChem CID 121402277) has the molecular formula C46H30N4 and a molecular weight of 638.77 g/mol. Its IUPAC name is 8-[4-[8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]quinoline.
| Compound Name | 8-[4-[8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]quinoline |
|---|---|
| PubChem CID | 121402277 |
| Molecular Formula | C46H30N4 |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | 8-[4-[8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]quinoline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4cccc5cccc(-c6ccc(-c7cccc8cccnc78)cc6)c45)cc3)n2)cc1 |
| InChI | InChI=1S/C46H30N4/c1-3-11-36(12-4-1)44-48-45(37-13-5-2-6-14-37)50-46(49-44)38-28-26-32(27-29-38)40-20-8-16-34-15-7-19-39(42(34)40)31-22-24-33(25-23-31)41-21-9-17-35-18-10-30-47-43(35)41/h1-30H |
| InChIKey | AYEFKNLPIJZHHJ-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |