About mercury;8-phenylquinoline;hydrate
mercury;8-phenylquinoline;hydrate (PubChem CID 174770535) has the molecular formula C15H13HgNO
and a molecular weight of 423.87 g/mol. Its IUPAC name is mercury;8-phenylquinoline;hydrate.
Molecular Properties
| Compound Name | mercury;8-phenylquinoline;hydrate |
| PubChem CID | 174770535 |
| Molecular Formula | C15H13HgNO |
| Molecular Weight | 423.87 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | mercury;8-phenylquinoline;hydrate |
| SMILES | O.[Hg].c1ccc(-c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C15H11N.Hg.H2O/c1-2-6-12(7-3-1)14-10-4-8-13-9-5-11-16-15(13)14;;/h1-11H;;1H2 |
| InChIKey | NMZRTQGKECKINM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 44.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.87 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze mercury;8-phenylquinoline;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury;8-phenylquinoline;hydrate?
The IUPAC name of mercury;8-phenylquinoline;hydrate (CID 174770535) is mercury;8-phenylquinoline;hydrate.
What is the SMILES notation for mercury;8-phenylquinoline;hydrate?
The canonical SMILES for mercury;8-phenylquinoline;hydrate is O.[Hg].c1ccc(-c2cccc3cccnc23)cc1.
What is the InChIKey of mercury;8-phenylquinoline;hydrate?
The InChIKey is NMZRTQGKECKINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N.Hg.H2O/c1-2-6-12(7-3-1)14-10-4-8-13-9-5-11-16-15(13)14;;/h1-11H;;1H2.
What are the key properties of mercury;8-phenylquinoline;hydrate?
mercury;8-phenylquinoline;hydrate has a molecular weight of 423.87 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for mercury;8-phenylquinoline;hydrate is sourced from PubChem (CID 174770535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).