About 8-phenylquinoline;2-pyridin-2-ylquinoline
8-phenylquinoline;2-pyridin-2-ylquinoline (PubChem CID 143968866) has the molecular formula C29H21N3
and a molecular weight of 411.51 g/mol. Its IUPAC name is 8-phenylquinoline;2-pyridin-2-ylquinoline.
Molecular Properties
| Compound Name | 8-phenylquinoline;2-pyridin-2-ylquinoline |
| PubChem CID | 143968866 |
| Molecular Formula | C29H21N3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 8-phenylquinoline;2-pyridin-2-ylquinoline |
| SMILES | c1ccc(-c2ccc3ccccc3n2)nc1.c1ccc(-c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C15H11N.C14H10N2/c1-2-6-12(7-3-1)14-10-4-8-13-9-5-11-16-15(13)14;1-2-6-12-11(5-1)8-9-14(16-12)13-7-3-4-10-15-13/h1-11H;1-10H |
| InChIKey | QHXMESFWTXLUEG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-phenylquinoline;2-pyridin-2-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-phenylquinoline;2-pyridin-2-ylquinoline?
The IUPAC name of 8-phenylquinoline;2-pyridin-2-ylquinoline (CID 143968866) is 8-phenylquinoline;2-pyridin-2-ylquinoline.
What is the SMILES notation for 8-phenylquinoline;2-pyridin-2-ylquinoline?
The canonical SMILES for 8-phenylquinoline;2-pyridin-2-ylquinoline is c1ccc(-c2ccc3ccccc3n2)nc1.c1ccc(-c2cccc3cccnc23)cc1.
What is the InChIKey of 8-phenylquinoline;2-pyridin-2-ylquinoline?
The InChIKey is QHXMESFWTXLUEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N.C14H10N2/c1-2-6-12(7-3-1)14-10-4-8-13-9-5-11-16-15(13)14;1-2-6-12-11(5-1)8-9-14(16-12)13-7-3-4-10-15-13/h1-11H;1-10H.
What are the key properties of 8-phenylquinoline;2-pyridin-2-ylquinoline?
8-phenylquinoline;2-pyridin-2-ylquinoline has a molecular weight of 411.51 g/mol, XLogP of 7.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-phenylquinoline;2-pyridin-2-ylquinoline is sourced from PubChem (CID 143968866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).