C32H23N3 — CID 155603380
8-[4-[2-methyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]quinoline (PubChem CID 155603380) has the molecular formula C32H23N3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 8-[4-[2-methyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]quinoline.
| Compound Name | 8-[4-[2-methyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]quinoline |
|---|---|
| PubChem CID | 155603380 |
| Molecular Formula | C32H23N3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 8-[4-[2-methyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]quinoline |
| SMILES | Cc1nc(-c2ccc(-c3cccc4cccnc34)cc2)cc(-c2cccc(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C32H23N3/c1-22-34-30(21-31(35-22)28-12-5-11-27(20-28)23-8-3-2-4-9-23)25-17-15-24(16-18-25)29-14-6-10-26-13-7-19-33-32(26)29/h2-21H,1H3 |
| InChIKey | XAMXWLCJDHXGLN-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |