C52H30N8 — CID 146230600
8-[4-phenyl-6-[6-(4-phenyl-6-quinolin-8-yl-1,3,5-triazin-2-yl)pyren-1-yl]-1,3,5-triazin-2-yl]quinoline (PubChem CID 146230600) has the molecular formula C52H30N8 and a molecular weight of 766.87 g/mol. Its IUPAC name is 8-[4-phenyl-6-[6-(4-phenyl-6-quinolin-8-yl-1,3,5-triazin-2-yl)pyren-1-yl]-1,3,5-triazin-2-yl]quinoline.
| Compound Name | 8-[4-phenyl-6-[6-(4-phenyl-6-quinolin-8-yl-1,3,5-triazin-2-yl)pyren-1-yl]-1,3,5-triazin-2-yl]quinoline |
|---|---|
| PubChem CID | 146230600 |
| Molecular Formula | C52H30N8 |
| Molecular Weight | 766.87 g/mol |
| Exact Mass | 766.26 |
| IUPAC Name | 8-[4-phenyl-6-[6-(4-phenyl-6-quinolin-8-yl-1,3,5-triazin-2-yl)pyren-1-yl]-1,3,5-triazin-2-yl]quinoline |
| SMILES | c1ccc(-c2nc(-c3ccc4ccc5c(-c6nc(-c7ccccc7)nc(-c7cccc8cccnc78)n6)ccc6ccc3c4c65)nc(-c3cccc4cccnc34)n2)cc1 |
| InChI | InChI=1S/C52H30N8/c1-3-11-35(12-4-1)47-55-49(59-51(57-47)41-19-7-15-33-17-9-29-53-45(33)41)39-27-23-31-22-26-38-40(28-24-32-21-25-37(39)43(31)44(32)38)50-56-48(36-13-5-2-6-14-36)58-52(60-50)42-20-8-16-34-18-10-30-54-46(34)42/h1-30H |
| InChIKey | KYNHURXSNZHKER-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.87 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|