C34H22N4 — CID 155792694
7-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzo[h]quinoline (PubChem CID 155792694) has the molecular formula C34H22N4 and a molecular weight of 486.58 g/mol. Its IUPAC name is 7-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzo[h]quinoline.
| Compound Name | 7-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzo[h]quinoline |
|---|---|
| PubChem CID | 155792694 |
| Molecular Formula | C34H22N4 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 7-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzo[h]quinoline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc5c4ccc4cccnc45)n3)cc2)cc1 |
| InChI | InChI=1S/C34H22N4/c1-3-9-23(10-4-1)24-16-18-27(19-17-24)33-36-32(26-11-5-2-6-12-26)37-34(38-33)30-15-7-14-29-28(30)21-20-25-13-8-22-35-31(25)29/h1-22H |
| InChIKey | GJVOAVOPMMUDGX-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|