C39H33N3 — CID 121315538
4,6-diphenyl-2-[4-[1-(4-pyridin-2-ylphenyl)cyclohexyl]phenyl]pyrimidine (PubChem CID 121315538) has the molecular formula C39H33N3 and a molecular weight of 543.71 g/mol. Its IUPAC name is 4,6-diphenyl-2-[4-[1-(4-pyridin-2-ylphenyl)cyclohexyl]phenyl]pyrimidine.
| Compound Name | 4,6-diphenyl-2-[4-[1-(4-pyridin-2-ylphenyl)cyclohexyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 121315538 |
| Molecular Formula | C39H33N3 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 4,6-diphenyl-2-[4-[1-(4-pyridin-2-ylphenyl)cyclohexyl]phenyl]pyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(C4(c5ccc(-c6ccccn6)cc5)CCCCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C39H33N3/c1-4-12-29(13-5-1)36-28-37(30-14-6-2-7-15-30)42-38(41-36)32-19-23-34(24-20-32)39(25-9-3-10-26-39)33-21-17-31(18-22-33)35-16-8-11-27-40-35/h1-2,4-8,11-24,27-28H,3,9-10,25-26H2 |
| InChIKey | FPLPBVHMAVLNFF-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |