C62H50N3OP — CID 176628441
2-[4-[2-[4-(10-dimethylphosphorylanthracen-9-yl)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 176628441) has the molecular formula C62H50N3OP and a molecular weight of 884.08 g/mol. Its IUPAC name is 2-[4-[2-[4-(10-dimethylphosphorylanthracen-9-yl)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[2-[4-(10-dimethylphosphorylanthracen-9-yl)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176628441 |
| Molecular Formula | C62H50N3OP |
| Molecular Weight | 884.08 g/mol |
| Exact Mass | 883.37 |
| IUPAC Name | 2-[4-[2-[4-(10-dimethylphosphorylanthracen-9-yl)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | CP(C)(=O)c1c2ccccc2c(-c2ccc(C3(c4ccc(-c5nc(-c6ccc(-c7ccccc7)cc6)nc(-c6ccc(-c7ccccc7)cc6)n5)cc4)CC4CCC3C4)cc2)c2ccccc12 |
| InChI | InChI=1S/C62H50N3OP/c1-67(2,66)58-55-19-11-9-17-53(55)57(54-18-10-12-20-56(54)58)46-30-35-50(36-31-46)62(40-41-21-34-52(62)39-41)51-37-32-49(33-38-51)61-64-59(47-26-22-44(23-27-47)42-13-5-3-6-14-42)63-60(65-61)48-28-24-45(25-29-48)43-15-7-4-8-16-43/h3-20,22-33,35-38,41,52H,21,34,39-40H2,1-2H3 |
| InChIKey | RQRUIPMKEVALQL-UHFFFAOYSA-N |
| XLogP | 15.53 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.08 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|