C26H31BO2 — CID 140808883
4,4,5,5-tetramethyl-2-(4-pentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8,10,12-hexaenyl)-1,3,2-dioxaborolane (PubChem CID 140808883) has the molecular formula C26H31BO2 and a molecular weight of 386.34 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(4-pentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8,10,12-hexaenyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(4-pentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8,10,12-hexaenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140808883 |
| Molecular Formula | C26H31BO2 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(4-pentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8,10,12-hexaenyl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc3c(c2)C24CCCC2(CCC4)c2ccccc2-3)OC1(C)C |
| InChI | InChI=1S/C26H31BO2/c1-23(2)24(3,4)29-27(28-23)18-11-12-20-19-9-5-6-10-21(19)25-13-7-15-26(25,16-8-14-25)22(20)17-18/h5-6,9-12,17H,7-8,13-16H2,1-4H3 |
| InChIKey | MNURXRBWMZDYPU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|