C33H37BO2 — CID 162519765
2-(9',9'-dimethylspiro[cyclohexane-1,14'-pentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene]-6'-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 162519765) has the molecular formula C33H37BO2 and a molecular weight of 476.47 g/mol. Its IUPAC name is 2-(9',9'-dimethylspiro[cyclohexane-1,14'-pentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene]-6'-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(9',9'-dimethylspiro[cyclohexane-1,14'-pentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene]-6'-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162519765 |
| Molecular Formula | C33H37BO2 |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 2-(9',9'-dimethylspiro[cyclohexane-1,14'-pentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene]-6'-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2c1ccc1c2-c2ccccc2C12CCCCC2 |
| InChI | InChI=1S/C33H37BO2/c1-30(2)25-16-17-26-29(22-12-8-9-13-24(22)33(26)18-10-7-11-19-33)28(25)23-15-14-21(20-27(23)30)34-35-31(3,4)32(5,6)36-34/h8-9,12-17,20H,7,10-11,18-19H2,1-6H3 |
| InChIKey | OUXWOVWGIQXHCU-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|