C27H35BO2 — CID 178037002
4,4,5,5-tetramethyl-2-(1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl)-1,3,2-dioxaborolane (PubChem CID 178037002) has the molecular formula C27H35BO2 and a molecular weight of 402.39 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 178037002 |
| Molecular Formula | C27H35BO2 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)CC2(CC(C)(C)c3cc(B4OC(C)(C)C(C)(C)O4)ccc32)c2ccccc21 |
| InChI | InChI=1S/C27H35BO2/c1-23(2)16-27(20-12-10-9-11-19(20)23)17-24(3,4)22-15-18(13-14-21(22)27)28-29-25(5,6)26(7,8)30-28/h9-15H,16-17H2,1-8H3 |
| InChIKey | JRNFBNACOODUKZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|