C24H32BNO2 — CID 140676905
5,5,7,7-tetramethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6H-cyclopenta[c]pyridine (PubChem CID 140676905) has the molecular formula C24H32BNO2 and a molecular weight of 377.34 g/mol. Its IUPAC name is 5,5,7,7-tetramethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6H-cyclopenta[c]pyridine.
| Compound Name | 5,5,7,7-tetramethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6H-cyclopenta[c]pyridine |
|---|---|
| PubChem CID | 140676905 |
| Molecular Formula | C24H32BNO2 |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 5,5,7,7-tetramethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6H-cyclopenta[c]pyridine |
| SMILES | CC1(C)CC(C)(C)c2cc(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3)ncc21 |
| InChI | InChI=1S/C24H32BNO2/c1-21(2)15-22(3,4)19-14-26-20(13-18(19)21)16-10-9-11-17(12-16)25-27-23(5,6)24(7,8)28-25/h9-14H,15H2,1-8H3 |
| InChIKey | ALFUNEUSXCLFNT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|