C22H29N — CID 140789867
5,5,7,7,9,9-hexamethyl-3-phenyl-6,8-dihydrocyclohepta[c]pyridine (PubChem CID 140789867) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is 5,5,7,7,9,9-hexamethyl-3-phenyl-6,8-dihydrocyclohepta[c]pyridine.
| Compound Name | 5,5,7,7,9,9-hexamethyl-3-phenyl-6,8-dihydrocyclohepta[c]pyridine |
|---|---|
| PubChem CID | 140789867 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 5,5,7,7,9,9-hexamethyl-3-phenyl-6,8-dihydrocyclohepta[c]pyridine |
| SMILES | CC1(C)CC(C)(C)c2cnc(-c3ccccc3)cc2C(C)(C)C1 |
| InChI | InChI=1S/C22H29N/c1-20(2)14-21(3,4)17-12-19(16-10-8-7-9-11-16)23-13-18(17)22(5,6)15-20/h7-13H,14-15H2,1-6H3 |
| InChIKey | XMPUPZICHGQHMM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |