C37H29N3 — CID 141492915
9,9-dimethyl-2,7-bis(6-phenyl-3-pyridinyl)-10H-acridine (PubChem CID 141492915) has the molecular formula C37H29N3 and a molecular weight of 515.66 g/mol. Its IUPAC name is 9,9-dimethyl-2,7-bis(6-phenyl-3-pyridinyl)-10H-acridine.
| Compound Name | 9,9-dimethyl-2,7-bis(6-phenyl-3-pyridinyl)-10H-acridine |
|---|---|
| PubChem CID | 141492915 |
| Molecular Formula | C37H29N3 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 9,9-dimethyl-2,7-bis(6-phenyl-3-pyridinyl)-10H-acridine |
| SMILES | CC1(C)c2cc(-c3ccc(-c4ccccc4)nc3)ccc2Nc2ccc(-c3ccc(-c4ccccc4)nc3)cc21 |
| InChI | InChI=1S/C37H29N3/c1-37(2)31-21-27(29-15-17-33(38-23-29)25-9-5-3-6-10-25)13-19-35(31)40-36-20-14-28(22-32(36)37)30-16-18-34(39-24-30)26-11-7-4-8-12-26/h3-24,40H,1-2H3 |
| InChIKey | BOZIRLJABFOYCH-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |