C29H28IrN2-2 — CID 140677107
iridium;2-phenylpyridine;5,5,7,7-tetramethyl-3-phenyl-6H-cyclopenta[c]pyridine (PubChem CID 140677107) has the molecular formula C29H28IrN2-2 and a molecular weight of 596.77 g/mol. Its IUPAC name is iridium;2-phenylpyridine;5,5,7,7-tetramethyl-3-phenyl-6H-cyclopenta[c]pyridine.
| Compound Name | iridium;2-phenylpyridine;5,5,7,7-tetramethyl-3-phenyl-6H-cyclopenta[c]pyridine |
|---|---|
| PubChem CID | 140677107 |
| Molecular Formula | C29H28IrN2-2 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | iridium;2-phenylpyridine;5,5,7,7-tetramethyl-3-phenyl-6H-cyclopenta[c]pyridine |
| SMILES | CC1(C)CC(C)(C)c2cc(-c3[c-]cccc3)ncc21.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C18H20N.C11H8N.Ir/c1-17(2)12-18(3,4)15-11-19-16(10-14(15)17)13-8-6-5-7-9-13;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-8,10-11H,12H2,1-4H3;1-6,8-9H;/q2*-1; |
| InChIKey | SOFYFRZXPMVPEA-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|