C44H56IrN2-2 — CID 140789866
2-(5,5,7,7,9,9-hexamethyl-6,8-dihydro-2H-benzo[7]annulen-2-id-3-yl)pyridine;5,5,7,7,9,9-hexamethyl-3-phenyl-6,8-dihydrocyclohepta[c]pyridine;iridium (PubChem CID 140789866) has the molecular formula C44H56IrN2-2 and a molecular weight of 805.16 g/mol. Its IUPAC name is 2-(5,5,7,7,9,9-hexamethyl-6,8-dihydro-2H-benzo[7]annulen-2-id-3-yl)pyridine;5,5,7,7,9,9-hexamethyl-3-phenyl-6,8-dihydrocyclohepta[c]pyridine;iridium.
| Compound Name | 2-(5,5,7,7,9,9-hexamethyl-6,8-dihydro-2H-benzo[7]annulen-2-id-3-yl)pyridine;5,5,7,7,9,9-hexamethyl-3-phenyl-6,8-dihydrocyclohepta[c]pyridine;iridium |
|---|---|
| PubChem CID | 140789866 |
| Molecular Formula | C44H56IrN2-2 |
| Molecular Weight | 805.16 g/mol |
| Exact Mass | 805.41 |
| IUPAC Name | 2-(5,5,7,7,9,9-hexamethyl-6,8-dihydro-2H-benzo[7]annulen-2-id-3-yl)pyridine;5,5,7,7,9,9-hexamethyl-3-phenyl-6,8-dihydrocyclohepta[c]pyridine;iridium |
| SMILES | CC1(C)CC(C)(C)c2c[c-]c(-c3ccccn3)cc2C(C)(C)C1.CC1(C)CC(C)(C)c2cnc(-c3[c-]cccc3)cc2C(C)(C)C1.[Ir] |
| InChI | InChI=1S/2C22H28N.Ir/c1-20(2)14-21(3,4)17-11-10-16(19-9-7-8-12-23-19)13-18(17)22(5,6)15-20;1-20(2)14-21(3,4)17-12-19(16-10-8-7-9-11-16)23-13-18(17)22(5,6)15-20;/h7-9,11-13H,14-15H2,1-6H3;7-10,12-13H,14-15H2,1-6H3;/q2*-1; |
| InChIKey | DIZSJOKUMZYYOJ-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.16 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|