C40H45BN4O2 — CID 58280815
2,4-bis(4-tert-butylphenyl)-6-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine (PubChem CID 58280815) has the molecular formula C40H45BN4O2 and a molecular weight of 624.64 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58280815 |
| Molecular Formula | C40H45BN4O2 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.36 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(-c4cccc(B5OC(C)(C)C(C)(C)O5)c4)nc3)n2)cc1 |
| InChI | InChI=1S/C40H45BN4O2/c1-37(2,3)30-19-14-26(15-20-30)34-43-35(27-16-21-31(22-17-27)38(4,5)6)45-36(44-34)29-18-23-33(42-25-29)28-12-11-13-32(24-28)41-46-39(7,8)40(9,10)47-41/h11-25H,1-10H3 |
| InChIKey | NJJOKHGMWRVXIV-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|