C38H45BO2Si — CID 177083301
diphenyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane (PubChem CID 177083301) has the molecular formula C38H45BO2Si and a molecular weight of 572.67 g/mol. Its IUPAC name is diphenyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane.
| Compound Name | diphenyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 177083301 |
| Molecular Formula | C38H45BO2Si |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | diphenyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane |
| SMILES | CC1(C)CCC(C)(C)c2cc([Si](c3ccccc3)(c3ccccc3)c3cccc(B4OC(C)(C)C(C)(C)O4)c3)ccc21 |
| InChI | InChI=1S/C38H45BO2Si/c1-35(2)24-25-36(3,4)34-27-32(22-23-33(34)35)42(29-17-11-9-12-18-29,30-19-13-10-14-20-30)31-21-15-16-28(26-31)39-40-37(5,6)38(7,8)41-39/h9-23,26-27H,24-25H2,1-8H3 |
| InChIKey | IPEYTSXISVJHBI-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|