C49H41BO2SSi — CID 176635576
diphenyl-spiro[fluorene-9,9'-thioxanthene]-3'-yl-[2,3,4,6-tetradeuterio-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane (PubChem CID 176635576) has the molecular formula C49H41BO2SSi and a molecular weight of 736.85 g/mol. Its IUPAC name is diphenyl-spiro[fluorene-9,9'-thioxanthene]-3'-yl-[2,3,4,6-tetradeuterio-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane.
| Compound Name | diphenyl-spiro[fluorene-9,9'-thioxanthene]-3'-yl-[2,3,4,6-tetradeuterio-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 176635576 |
| Molecular Formula | C49H41BO2SSi |
| Molecular Weight | 736.85 g/mol |
| Exact Mass | 736.29 |
| IUPAC Name | diphenyl-spiro[fluorene-9,9'-thioxanthene]-3'-yl-[2,3,4,6-tetradeuterio-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane |
| SMILES | [2H]c1c([2H])c(B2OC(C)(C)C(C)(C)O2)c([2H])c([Si](c2ccccc2)(c2ccccc2)c2ccc3c(c2)Sc2ccccc2C32c3ccccc3-c3ccccc32)c1[2H] |
| InChI | InChI=1S/C49H41BO2SSi/c1-47(2)48(3,4)52-50(51-47)34-18-17-23-37(32-34)54(35-19-7-5-8-20-35,36-21-9-6-10-22-36)38-30-31-44-46(33-38)53-45-29-16-15-28-43(45)49(44)41-26-13-11-24-39(41)40-25-12-14-27-42(40)49/h5-33H,1-4H3/i17D,18D,23D,32D |
| InChIKey | LBYVRTXNGBDOTO-GIIFNQOJSA-N |
| XLogP | 8.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.85 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|