C43H36Si2 — CID 170660205
diphenyl-(2,3,4,6-tetradeuterio-5-methylphenyl)-(3-triphenylsilylphenyl)silane (PubChem CID 170660205) has the molecular formula C43H36Si2 and a molecular weight of 612.96 g/mol. Its IUPAC name is diphenyl-(2,3,4,6-tetradeuterio-5-methylphenyl)-(3-triphenylsilylphenyl)silane.
| Compound Name | diphenyl-(2,3,4,6-tetradeuterio-5-methylphenyl)-(3-triphenylsilylphenyl)silane |
|---|---|
| PubChem CID | 170660205 |
| Molecular Formula | C43H36Si2 |
| Molecular Weight | 612.96 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | diphenyl-(2,3,4,6-tetradeuterio-5-methylphenyl)-(3-triphenylsilylphenyl)silane |
| SMILES | [2H]c1c([2H])c(C)c([2H])c([Si](c2ccccc2)(c2ccccc2)c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)c1[2H] |
| InChI | InChI=1S/C43H36Si2/c1-35-19-17-30-41(33-35)45(39-26-13-5-14-27-39,40-28-15-6-16-29-40)43-32-18-31-42(34-43)44(36-20-7-2-8-21-36,37-22-9-3-10-23-37)38-24-11-4-12-25-38/h2-34H,1H3/i17D,19D,30D,33D |
| InChIKey | IPHLHXOWPCXBKJ-JGRLLQNGSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.96 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|