C30H21BrOSi — CID 177083272
(3-bromophenyl)-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-diphenylsilane (PubChem CID 177083272) has the molecular formula C30H21BrOSi and a molecular weight of 512.53 g/mol. Its IUPAC name is (3-bromophenyl)-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-diphenylsilane.
| Compound Name | (3-bromophenyl)-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-diphenylsilane |
|---|---|
| PubChem CID | 177083272 |
| Molecular Formula | C30H21BrOSi |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | (3-bromophenyl)-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-diphenylsilane |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c([Si](c4ccccc4)(c4ccccc4)c4cccc(Br)c4)c([2H])c32)c1[2H] |
| InChI | InChI=1S/C30H21BrOSi/c31-22-10-9-15-25(20-22)33(23-11-3-1-4-12-23,24-13-5-2-6-14-24)26-18-19-30-28(21-26)27-16-7-8-17-29(27)32-30/h1-21H/i7D,8D,16D,17D,18D,19D,21D |
| InChIKey | XEGIKCCTCPJZFY-BXYOHHMMSA-N |
| XLogP | 5.73 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|