C24H19BrSi — CID 162701572
(4-bromophenyl)-(2,3,4,5,6-pentadeuteriophenyl)-diphenylsilane (PubChem CID 162701572) has the molecular formula C24H19BrSi and a molecular weight of 420.44 g/mol. Its IUPAC name is (4-bromophenyl)-(2,3,4,5,6-pentadeuteriophenyl)-diphenylsilane.
| Compound Name | (4-bromophenyl)-(2,3,4,5,6-pentadeuteriophenyl)-diphenylsilane |
|---|---|
| PubChem CID | 162701572 |
| Molecular Formula | C24H19BrSi |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | (4-bromophenyl)-(2,3,4,5,6-pentadeuteriophenyl)-diphenylsilane |
| SMILES | [2H]c1c([2H])c([2H])c([Si](c2ccccc2)(c2ccccc2)c2ccc(Br)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C24H19BrSi/c25-20-16-18-24(19-17-20)26(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19H/i1D,4D,5D,10D,11D |
| InChIKey | UDZSLJULKCKKPX-ZWYOJXJXSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|