C31H26Si — CID 170660160
triphenyl-[2,4,6-trideuterio-3-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]silane (PubChem CID 170660160) has the molecular formula C31H26Si and a molecular weight of 434.68 g/mol. Its IUPAC name is triphenyl-[2,4,6-trideuterio-3-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]silane.
| Compound Name | triphenyl-[2,4,6-trideuterio-3-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]silane |
|---|---|
| PubChem CID | 170660160 |
| Molecular Formula | C31H26Si |
| Molecular Weight | 434.68 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | triphenyl-[2,4,6-trideuterio-3-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]silane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c(C)c([2H])c([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C31H26Si/c1-25-22-27(26-14-6-2-7-15-26)24-31(23-25)32(28-16-8-3-9-17-28,29-18-10-4-11-19-29)30-20-12-5-13-21-30/h2-24H,1H3/i2D,6D,7D,14D,15D,22D,23D,24D |
| InChIKey | JTLFRSMFUJMZTF-PLRIBTEZSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.68 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|