C45H32N4Si — CID 164843236
[3-[4-carbazol-9-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-2,4,5,6-tetradeuteriophenyl]-triphenylsilane (PubChem CID 164843236) has the molecular formula C45H32N4Si and a molecular weight of 665.92 g/mol. Its IUPAC name is [3-[4-carbazol-9-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-2,4,5,6-tetradeuteriophenyl]-triphenylsilane.
| Compound Name | [3-[4-carbazol-9-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-2,4,5,6-tetradeuteriophenyl]-triphenylsilane |
|---|---|
| PubChem CID | 164843236 |
| Molecular Formula | C45H32N4Si |
| Molecular Weight | 665.92 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | [3-[4-carbazol-9-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-2,4,5,6-tetradeuteriophenyl]-triphenylsilane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3c([2H])c([2H])c([2H])c([Si](c4ccccc4)(c4ccccc4)c4ccccc4)c3[2H])nc(-n3c4ccccc4c4ccccc43)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H32N4Si/c1-5-18-33(19-6-1)43-46-44(48-45(47-43)49-41-30-15-13-28-39(41)40-29-14-16-31-42(40)49)34-20-17-27-38(32-34)50(35-21-7-2-8-22-35,36-23-9-3-10-24-36)37-25-11-4-12-26-37/h1-32H/i1D,5D,6D,17D,18D,19D,20D,27D,32D |
| InChIKey | RJBADEIGCDDRKG-XGMXSCDWSA-N |
| XLogP | 7.68 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.92 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|