C51H35N5Si — CID 164843270
(2,3,4,5,6-pentadeuteriophenyl)-diphenyl-[2,3,4,6-tetradeuterio-5-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]silane (PubChem CID 164843270) has the molecular formula C51H35N5Si and a molecular weight of 755.02 g/mol. Its IUPAC name is (2,3,4,5,6-pentadeuteriophenyl)-diphenyl-[2,3,4,6-tetradeuterio-5-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]silane.
| Compound Name | (2,3,4,5,6-pentadeuteriophenyl)-diphenyl-[2,3,4,6-tetradeuterio-5-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 164843270 |
| Molecular Formula | C51H35N5Si |
| Molecular Weight | 755.02 g/mol |
| Exact Mass | 754.32 |
| IUPAC Name | (2,3,4,5,6-pentadeuteriophenyl)-diphenyl-[2,3,4,6-tetradeuterio-5-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]silane |
| SMILES | [2H]c1c([2H])c([2H])c([Si](c2ccccc2)(c2ccccc2)c2c([2H])c([2H])c([2H])c(-c3nc(-n4c5ccccc5c5ccccc54)nc(-n4c5ccccc5c5ccccc54)n3)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C51H35N5Si/c1-4-20-37(21-5-1)57(38-22-6-2-7-23-38,39-24-8-3-9-25-39)40-26-18-19-36(35-40)49-52-50(55-45-31-14-10-27-41(45)42-28-11-15-32-46(42)55)54-51(53-49)56-47-33-16-12-29-43(47)44-30-13-17-34-48(44)56/h1-35H/i1D,4D,5D,18D,19D,20D,21D,26D,35D |
| InChIKey | MZZBVCAAWVBQJO-OKVDIJBPSA-N |
| XLogP | 9.11 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.02 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|