C63H46N4Si2 — CID 162492117
[4-[4-carbazol-9-yl-6-(4-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane (PubChem CID 162492117) has the molecular formula C63H46N4Si2 and a molecular weight of 915.26 g/mol. Its IUPAC name is [4-[4-carbazol-9-yl-6-(4-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane.
| Compound Name | [4-[4-carbazol-9-yl-6-(4-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 162492117 |
| Molecular Formula | C63H46N4Si2 |
| Molecular Weight | 915.26 g/mol |
| Exact Mass | 914.33 |
| IUPAC Name | [4-[4-carbazol-9-yl-6-(4-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
| SMILES | c1ccc([Si](c2ccccc2)(c2ccccc2)c2ccc(-c3nc(-c4ccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)cc4)nc(-n4c5ccccc5c5ccccc54)n3)cc2)cc1 |
| InChI | InChI=1S/C63H46N4Si2/c1-7-23-49(24-8-1)68(50-25-9-2-10-26-50,51-27-11-3-12-28-51)55-43-39-47(40-44-55)61-64-62(66-63(65-61)67-59-37-21-19-35-57(59)58-36-20-22-38-60(58)67)48-41-45-56(46-42-48)69(52-29-13-4-14-30-52,53-31-15-5-16-32-53)54-33-17-6-18-34-54/h1-46H |
| InChIKey | SFEWZAMOSNTNCT-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.26 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|