C71H50N4Si2 — CID 58556489
[9-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)-6-triphenylsilylcarbazol-3-yl]-triphenylsilane (PubChem CID 58556489) has the molecular formula C71H50N4Si2 and a molecular weight of 1015.38 g/mol. Its IUPAC name is [9-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)-6-triphenylsilylcarbazol-3-yl]-triphenylsilane.
| Compound Name | [9-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)-6-triphenylsilylcarbazol-3-yl]-triphenylsilane |
|---|---|
| PubChem CID | 58556489 |
| Molecular Formula | C71H50N4Si2 |
| Molecular Weight | 1015.38 g/mol |
| Exact Mass | 1014.36 |
| IUPAC Name | [9-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)-6-triphenylsilylcarbazol-3-yl]-triphenylsilane |
| SMILES | c1ccc([Si](c2ccccc2)(c2ccccc2)c2ccc3c(c2)c2cc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)ccc2n3-c2nc(-c3ccc4ccccc4c3)nc(-c3ccc4ccccc4c3)n2)cc1 |
| InChI | InChI=1S/C71H50N4Si2/c1-7-27-57(28-8-1)76(58-29-9-2-10-30-58,59-31-11-3-12-32-59)63-43-45-67-65(49-63)66-50-64(77(60-33-13-4-14-34-60,61-35-15-5-16-36-61)62-37-17-6-18-38-62)44-46-68(66)75(67)71-73-69(55-41-39-51-23-19-21-25-53(51)47-55)72-70(74-71)56-42-40-52-24-20-22-26-54(52)48-56/h1-50H |
| InChIKey | IYHDBTWGENLIMO-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.38 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|